C10H6Cl4O — CID 60800406
4-(2,3,5,6-tetrachlorophenyl)but-3-yn-1-ol (PubChem CID 60800406) has the molecular formula C10H6Cl4O and a molecular weight of 283.97 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrachlorophenyl)but-3-yn-1-ol.
| Compound Name | 4-(2,3,5,6-tetrachlorophenyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 60800406 |
| Molecular Formula | C10H6Cl4O |
| Molecular Weight | 283.97 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 4-(2,3,5,6-tetrachlorophenyl)but-3-yn-1-ol |
| SMILES | OCCC#Cc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl4O/c11-7-5-8(12)10(14)6(9(7)13)3-1-2-4-15/h5,15H,2,4H2 |
| InChIKey | MYWSCKXTUGBNAM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|