C11H9ClF2O — CID 107476752
5-(2-chloro-4,5-difluorophenyl)pent-4-yn-1-ol (PubChem CID 107476752) has the molecular formula C11H9ClF2O and a molecular weight of 230.64 g/mol. Its IUPAC name is 5-(2-chloro-4,5-difluorophenyl)pent-4-yn-1-ol.
| Compound Name | 5-(2-chloro-4,5-difluorophenyl)pent-4-yn-1-ol |
|---|---|
| PubChem CID | 107476752 |
| Molecular Formula | C11H9ClF2O |
| Molecular Weight | 230.64 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-(2-chloro-4,5-difluorophenyl)pent-4-yn-1-ol |
| SMILES | OCCCC#Cc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H9ClF2O/c12-9-7-11(14)10(13)6-8(9)4-2-1-3-5-15/h6-7,15H,1,3,5H2 |
| InChIKey | SUBJPTZSBYUEDJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|