C11H8Cl4O — CID 105349771
5-(2,3,4,6-tetrachlorophenyl)pent-4-yn-1-ol (PubChem CID 105349771) has the molecular formula C11H8Cl4O and a molecular weight of 298.00 g/mol. Its IUPAC name is 5-(2,3,4,6-tetrachlorophenyl)pent-4-yn-1-ol.
| Compound Name | 5-(2,3,4,6-tetrachlorophenyl)pent-4-yn-1-ol |
|---|---|
| PubChem CID | 105349771 |
| Molecular Formula | C11H8Cl4O |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | 5-(2,3,4,6-tetrachlorophenyl)pent-4-yn-1-ol |
| SMILES | OCCCC#Cc1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl4O/c12-8-6-9(13)11(15)10(14)7(8)4-2-1-3-5-16/h6,16H,1,3,5H2 |
| InChIKey | JQJAJBRDTAGUGS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|