C10H8ClF2N — CID 170467805
2-(4-chlorobut-1-ynyl)-4,5-difluoroaniline (PubChem CID 170467805) has the molecular formula C10H8ClF2N and a molecular weight of 215.63 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-4,5-difluoroaniline.
| Compound Name | 2-(4-chlorobut-1-ynyl)-4,5-difluoroaniline |
|---|---|
| PubChem CID | 170467805 |
| Molecular Formula | C10H8ClF2N |
| Molecular Weight | 215.63 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-4,5-difluoroaniline |
| SMILES | Nc1cc(F)c(F)cc1C#CCCCl |
| InChI | InChI=1S/C10H8ClF2N/c11-4-2-1-3-7-5-8(12)9(13)6-10(7)14/h5-6H,2,4,14H2 |
| InChIKey | PTHXTADIGDIEKC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|