C17H13ClF2O — CID 82915087
4-[[2-(4-chlorobut-1-ynyl)phenoxy]methyl]-1,2-difluorobenzene (PubChem CID 82915087) has the molecular formula C17H13ClF2O and a molecular weight of 306.74 g/mol. Its IUPAC name is 4-[[2-(4-chlorobut-1-ynyl)phenoxy]methyl]-1,2-difluorobenzene.
| Compound Name | 4-[[2-(4-chlorobut-1-ynyl)phenoxy]methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 82915087 |
| Molecular Formula | C17H13ClF2O |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-[[2-(4-chlorobut-1-ynyl)phenoxy]methyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(COc2ccccc2C#CCCCl)cc1F |
| InChI | InChI=1S/C17H13ClF2O/c18-10-4-3-6-14-5-1-2-7-17(14)21-12-13-8-9-15(19)16(20)11-13/h1-2,5,7-9,11H,4,10,12H2 |
| InChIKey | PYOIFYXCOFCVKX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|