C14H11BrF2O — CID 82919067
4-[[2-(bromomethyl)phenoxy]methyl]-1,2-difluorobenzene (PubChem CID 82919067) has the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. Its IUPAC name is 4-[[2-(bromomethyl)phenoxy]methyl]-1,2-difluorobenzene.
| Compound Name | 4-[[2-(bromomethyl)phenoxy]methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 82919067 |
| Molecular Formula | C14H11BrF2O |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 4-[[2-(bromomethyl)phenoxy]methyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(COc2ccccc2CBr)cc1F |
| InChI | InChI=1S/C14H11BrF2O/c15-8-11-3-1-2-4-14(11)18-9-10-5-6-12(16)13(17)7-10/h1-7H,8-9H2 |
| InChIKey | ZPNOKQZXXQLXHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|