C17H11BrF2O — CID 78909521
1-bromo-2-[(3,4-difluorophenyl)methoxy]naphthalene (PubChem CID 78909521) has the molecular formula C17H11BrF2O and a molecular weight of 349.17 g/mol. Its IUPAC name is 1-bromo-2-[(3,4-difluorophenyl)methoxy]naphthalene.
| Compound Name | 1-bromo-2-[(3,4-difluorophenyl)methoxy]naphthalene |
|---|---|
| PubChem CID | 78909521 |
| Molecular Formula | C17H11BrF2O |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-bromo-2-[(3,4-difluorophenyl)methoxy]naphthalene |
| SMILES | Fc1ccc(COc2ccc3ccccc3c2Br)cc1F |
| InChI | InChI=1S/C17H11BrF2O/c18-17-13-4-2-1-3-12(13)6-8-16(17)21-10-11-5-7-14(19)15(20)9-11/h1-9H,10H2 |
| InChIKey | OLEVFUDSKHZXBI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |