C16H8F2O4 — CID 164598502
1,10-difluoro-3-hydroxy-8-(3-hydroxyprop-1-ynyl)benzo[c]chromen-6-one (PubChem CID 164598502) has the molecular formula C16H8F2O4 and a molecular weight of 302.23 g/mol. Its IUPAC name is 1,10-difluoro-3-hydroxy-8-(3-hydroxyprop-1-ynyl)benzo[c]chromen-6-one.
| Compound Name | 1,10-difluoro-3-hydroxy-8-(3-hydroxyprop-1-ynyl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598502 |
| Molecular Formula | C16H8F2O4 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1,10-difluoro-3-hydroxy-8-(3-hydroxyprop-1-ynyl)benzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(F)c2c2c(F)cc(C#CCO)cc12 |
| InChI | InChI=1S/C16H8F2O4/c17-11-5-8(2-1-3-19)4-10-14(11)15-12(18)6-9(20)7-13(15)22-16(10)21/h4-7,19-20H,3H2 |
| InChIKey | MKBCSGPONNFLOT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|