C18H13NO4 — CID 170381140
N-[3-(3-hydroxy-6-oxobenzo[c]chromen-8-yl)prop-2-ynyl]acetamide (PubChem CID 170381140) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[3-(3-hydroxy-6-oxobenzo[c]chromen-8-yl)prop-2-ynyl]acetamide.
| Compound Name | N-[3-(3-hydroxy-6-oxobenzo[c]chromen-8-yl)prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 170381140 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[3-(3-hydroxy-6-oxobenzo[c]chromen-8-yl)prop-2-ynyl]acetamide |
| SMILES | CC(=O)NCC#Cc1ccc2c(c1)c(=O)oc1cc(O)ccc12 |
| InChI | InChI=1S/C18H13NO4/c1-11(20)19-8-2-3-12-4-6-14-15-7-5-13(21)10-17(15)23-18(22)16(14)9-12/h4-7,9-10,21H,8H2,1H3,(H,19,20) |
| InChIKey | PBBBDHLNGCMRHV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|