About holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one
holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one (PubChem CID 164598448) has the molecular formula C17H11HoO3-
and a molecular weight of 428.20 g/mol. Its IUPAC name is holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one.
Molecular Properties
| Compound Name | holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one |
| PubChem CID | 164598448 |
| Molecular Formula | C17H11HoO3- |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one |
| SMILES | COCC#Cc1ccc2c(c1)c(=O)oc1c[c-]ccc12.[Ho] |
| InChI | InChI=1S/C17H11O3.Ho/c1-19-10-4-5-12-8-9-13-14-6-2-3-7-16(14)20-17(18)15(13)11-12;/h2,6-9,11H,10H2,1H3;/q-1; |
| InChIKey | PBOVGVIUDNYWNP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one?
The IUPAC name of holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one (CID 164598448) is holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one.
What is the SMILES notation for holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one?
The canonical SMILES for holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one is COCC#Cc1ccc2c(c1)c(=O)oc1c[c-]ccc12.[Ho].
What is the InChIKey of holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one?
The InChIKey is PBOVGVIUDNYWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11O3.Ho/c1-19-10-4-5-12-8-9-13-14-6-2-3-7-16(14)20-17(18)15(13)11-12;/h2,6-9,11H,10H2,1H3;/q-1;.
What are the key properties of holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one?
holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one has a molecular weight of 428.20 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for holmium;8-(3-methoxyprop-1-ynyl)-3H-benzo[c]chromen-3-id-6-one is sourced from PubChem (CID 164598448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).