C27H33NO3S — CID 172595862
3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-8-(3-piperidin-1-ylprop-1-ynyl)benzo[c]chromen-6-one (PubChem CID 172595862) has the molecular formula C27H33NO3S and a molecular weight of 451.63 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-8-(3-piperidin-1-ylprop-1-ynyl)benzo[c]chromen-6-one.
| Compound Name | 3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-8-(3-piperidin-1-ylprop-1-ynyl)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 172595862 |
| Molecular Formula | C27H33NO3S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-8-(3-piperidin-1-ylprop-1-ynyl)benzo[c]chromen-6-one |
| SMILES | CC(C)(C)S(C)(C)Oc1ccc2c(c1)oc(=O)c1cc(C#CCN3CCCCC3)ccc12 |
| InChI | InChI=1S/C27H33NO3S/c1-27(2,3)32(4,5)31-21-12-14-23-22-13-11-20(10-9-17-28-15-7-6-8-16-28)18-24(22)26(29)30-25(23)19-21/h11-14,18-19H,6-8,15-17H2,1-5H3 |
| InChIKey | PWXBZZOJGDRCDJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|