C20H16F2O3 — CID 167703803
8-(3-ethyl-1-bicyclo[1.1.1]pentanyl)-1,10-difluoro-3-hydroxybenzo[c]chromen-6-one (PubChem CID 167703803) has the molecular formula C20H16F2O3 and a molecular weight of 342.34 g/mol. Its IUPAC name is 8-(3-ethyl-1-bicyclo[1.1.1]pentanyl)-1,10-difluoro-3-hydroxybenzo[c]chromen-6-one.
| Compound Name | 8-(3-ethyl-1-bicyclo[1.1.1]pentanyl)-1,10-difluoro-3-hydroxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 167703803 |
| Molecular Formula | C20H16F2O3 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 8-(3-ethyl-1-bicyclo[1.1.1]pentanyl)-1,10-difluoro-3-hydroxybenzo[c]chromen-6-one |
| SMILES | CCC12CC(c3cc(F)c4c(c3)c(=O)oc3cc(O)cc(F)c34)(C1)C2 |
| InChI | InChI=1S/C20H16F2O3/c1-2-19-7-20(8-19,9-19)10-3-12-16(13(21)4-10)17-14(22)5-11(23)6-15(17)25-18(12)24/h3-6,23H,2,7-9H2,1H3 |
| InChIKey | VPJUUGKGZUKOTQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|