C19H14F2O4 — CID 164598380
1,10-difluoro-3-hydroxy-8-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]benzo[c]chromen-6-one (PubChem CID 164598380) has the molecular formula C19H14F2O4 and a molecular weight of 344.31 g/mol. Its IUPAC name is 1,10-difluoro-3-hydroxy-8-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]benzo[c]chromen-6-one.
| Compound Name | 1,10-difluoro-3-hydroxy-8-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598380 |
| Molecular Formula | C19H14F2O4 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1,10-difluoro-3-hydroxy-8-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]benzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(F)c2c2c(F)cc(C34CC(CO)(C3)C4)cc12 |
| InChI | InChI=1S/C19H14F2O4/c20-12-2-9(19-5-18(6-19,7-19)8-22)1-11-15(12)16-13(21)3-10(23)4-14(16)25-17(11)24/h1-4,22-23H,5-8H2 |
| InChIKey | GBMMOJAORAHSKT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|