C18H14F2O5 — CID 164598272
1,10-difluoro-3-hydroxy-8-(oxan-4-yloxy)benzo[c]chromen-6-one (PubChem CID 164598272) has the molecular formula C18H14F2O5 and a molecular weight of 348.30 g/mol. Its IUPAC name is 1,10-difluoro-3-hydroxy-8-(oxan-4-yloxy)benzo[c]chromen-6-one.
| Compound Name | 1,10-difluoro-3-hydroxy-8-(oxan-4-yloxy)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598272 |
| Molecular Formula | C18H14F2O5 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,10-difluoro-3-hydroxy-8-(oxan-4-yloxy)benzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(F)c2c2c(F)cc(OC3CCOCC3)cc12 |
| InChI | InChI=1S/C18H14F2O5/c19-13-5-9(21)6-15-17(13)16-12(18(22)25-15)7-11(8-14(16)20)24-10-1-3-23-4-2-10/h5-8,10,21H,1-4H2 |
| InChIKey | MDDAWVYJOMIGLC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|