C39H40N2O8 — CID 164598391
3-(dimethylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one;3-(methylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one (PubChem CID 164598391) has the molecular formula C39H40N2O8 and a molecular weight of 664.76 g/mol. Its IUPAC name is 3-(dimethylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one;3-(methylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one.
| Compound Name | 3-(dimethylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one;3-(methylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598391 |
| Molecular Formula | C39H40N2O8 |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | 3-(dimethylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one;3-(methylamino)-8-(oxan-4-yloxy)benzo[c]chromen-6-one |
| SMILES | CN(C)c1ccc2c(c1)oc(=O)c1cc(OC3CCOCC3)ccc12.CNc1ccc2c(c1)oc(=O)c1cc(OC3CCOCC3)ccc12 |
| InChI | InChI=1S/C20H21NO4.C19H19NO4/c1-21(2)13-3-5-17-16-6-4-15(24-14-7-9-23-10-8-14)12-18(16)20(22)25-19(17)11-13;1-20-12-2-4-16-15-5-3-14(23-13-6-8-22-9-7-13)11-17(15)19(21)24-18(16)10-12/h3-6,11-12,14H,7-10H2,1-2H3;2-5,10-11,13,20H,6-9H2,1H3 |
| InChIKey | JMCZEJKAQPHNDG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|