C17H13ClO5 — CID 164598650
2-chloro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one (PubChem CID 164598650) has the molecular formula C17H13ClO5 and a molecular weight of 332.74 g/mol. Its IUPAC name is 2-chloro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 2-chloro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598650 |
| Molecular Formula | C17H13ClO5 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-chloro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)c(Cl)cc2c2ccc(O[C@H]3CCOC3)cc12 |
| InChI | InChI=1S/C17H13ClO5/c18-14-6-12-11-2-1-9(22-10-3-4-21-8-10)5-13(11)17(20)23-16(12)7-15(14)19/h1-2,5-7,10,19H,3-4,8H2/t10-/m0/s1 |
| InChIKey | XKUHCLNPVLDXFM-JTQLQIEISA-N |
| XLogP | 3.47 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|