C17H13FO5 — CID 164598513
1-fluoro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one (PubChem CID 164598513) has the molecular formula C17H13FO5 and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-fluoro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one.
| Compound Name | 1-fluoro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 164598513 |
| Molecular Formula | C17H13FO5 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-fluoro-3-hydroxy-8-[(3S)-oxolan-3-yl]oxybenzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(O)cc(F)c2c2ccc(O[C@H]3CCOC3)cc12 |
| InChI | InChI=1S/C17H13FO5/c18-14-5-9(19)6-15-16(14)12-2-1-10(7-13(12)17(20)23-15)22-11-3-4-21-8-11/h1-2,5-7,11,19H,3-4,8H2/t11-/m0/s1 |
| InChIKey | HRKTTXFPMGAFGM-NSHDSACASA-N |
| XLogP | 2.96 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|