C12H11F2NO3 — CID 169354891
4-(2,6-difluoro-4-isocyanatophenoxy)oxane (PubChem CID 169354891) has the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-isocyanatophenoxy)oxane.
| Compound Name | 4-(2,6-difluoro-4-isocyanatophenoxy)oxane |
|---|---|
| PubChem CID | 169354891 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-(2,6-difluoro-4-isocyanatophenoxy)oxane |
| SMILES | O=C=Nc1cc(F)c(OC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C12H11F2NO3/c13-10-5-8(15-7-16)6-11(14)12(10)18-9-1-3-17-4-2-9/h5-6,9H,1-4H2 |
| InChIKey | ABVMPHZXLIGWIX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|