C11H13F2NO2 — CID 115507352
2,4-difluoro-6-(oxan-4-yloxy)aniline (PubChem CID 115507352) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2,4-difluoro-6-(oxan-4-yloxy)aniline.
| Compound Name | 2,4-difluoro-6-(oxan-4-yloxy)aniline |
|---|---|
| PubChem CID | 115507352 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2,4-difluoro-6-(oxan-4-yloxy)aniline |
| SMILES | Nc1c(F)cc(F)cc1OC1CCOCC1 |
| InChI | InChI=1S/C11H13F2NO2/c12-7-5-9(13)11(14)10(6-7)16-8-1-3-15-4-2-8/h5-6,8H,1-4,14H2 |
| InChIKey | VYJJZDIAHAGTKO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|