C14H19F2NO2 — CID 79892393
N-[[3,5-difluoro-4-(oxan-4-yloxy)phenyl]methyl]ethanamine (PubChem CID 79892393) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(oxan-4-yloxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-difluoro-4-(oxan-4-yloxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 79892393 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[[3,5-difluoro-4-(oxan-4-yloxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)c(OC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-2-17-9-10-7-12(15)14(13(16)8-10)19-11-3-5-18-6-4-11/h7-8,11,17H,2-6,9H2,1H3 |
| InChIKey | MAMMCAMTQGRMOM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |