C10H10F2O2 — CID 126982122
(4-cyclopropyloxy-3,5-difluorophenyl)methanol (PubChem CID 126982122) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is (4-cyclopropyloxy-3,5-difluorophenyl)methanol.
| Compound Name | (4-cyclopropyloxy-3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 126982122 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4-cyclopropyloxy-3,5-difluorophenyl)methanol |
| SMILES | OCc1cc(F)c(OC2CC2)c(F)c1 |
| InChI | InChI=1S/C10H10F2O2/c11-8-3-6(5-13)4-9(12)10(8)14-7-1-2-7/h3-4,7,13H,1-2,5H2 |
| InChIKey | YZVVLNKXTMSPHG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |