About (4-cyclopropyloxy-3,5-difluorophenyl)methanol
(4-cyclopropyloxy-3,5-difluorophenyl)methanol (PubChem CID 126982122) has the molecular formula C10H10F2O2
and a molecular weight of 200.18 g/mol. Its IUPAC name is (4-cyclopropyloxy-3,5-difluorophenyl)methanol.
Molecular Properties
| Compound Name | (4-cyclopropyloxy-3,5-difluorophenyl)methanol |
| PubChem CID | 126982122 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4-cyclopropyloxy-3,5-difluorophenyl)methanol |
| SMILES | OCc1cc(F)c(OC2CC2)c(F)c1 |
| InChI | InChI=1S/C10H10F2O2/c11-8-3-6(5-13)4-9(12)10(8)14-7-1-2-7/h3-4,7,13H,1-2,5H2 |
| InChIKey | YZVVLNKXTMSPHG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-cyclopropyloxy-3,5-difluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyloxy-3,5-difluorophenyl)methanol?
The IUPAC name of (4-cyclopropyloxy-3,5-difluorophenyl)methanol (CID 126982122) is (4-cyclopropyloxy-3,5-difluorophenyl)methanol.
What is the SMILES notation for (4-cyclopropyloxy-3,5-difluorophenyl)methanol?
The canonical SMILES for (4-cyclopropyloxy-3,5-difluorophenyl)methanol is OCc1cc(F)c(OC2CC2)c(F)c1.
What is the InChIKey of (4-cyclopropyloxy-3,5-difluorophenyl)methanol?
The InChIKey is YZVVLNKXTMSPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O2/c11-8-3-6(5-13)4-9(12)10(8)14-7-1-2-7/h3-4,7,13H,1-2,5H2.
What are the key properties of (4-cyclopropyloxy-3,5-difluorophenyl)methanol?
(4-cyclopropyloxy-3,5-difluorophenyl)methanol has a molecular weight of 200.18 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyloxy-3,5-difluorophenyl)methanol is sourced from PubChem (CID 126982122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).