C12H14F2O3 — CID 106929822
[4-(cyclopropylmethoxymethoxy)-3,5-difluorophenyl]methanol (PubChem CID 106929822) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is [4-(cyclopropylmethoxymethoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(cyclopropylmethoxymethoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 106929822 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [4-(cyclopropylmethoxymethoxy)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(OCOCC2CC2)c(F)c1 |
| InChI | InChI=1S/C12H14F2O3/c13-10-3-9(5-15)4-11(14)12(10)17-7-16-6-8-1-2-8/h3-4,8,15H,1-2,5-7H2 |
| InChIKey | XWVRBTSOMIAGBU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|