C11H11BrF2O — CID 79887966
5-(bromomethyl)-2-(cyclopropylmethoxy)-1,3-difluorobenzene (PubChem CID 79887966) has the molecular formula C11H11BrF2O and a molecular weight of 277.11 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(cyclopropylmethoxy)-1,3-difluorobenzene.
| Compound Name | 5-(bromomethyl)-2-(cyclopropylmethoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 79887966 |
| Molecular Formula | C11H11BrF2O |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 5-(bromomethyl)-2-(cyclopropylmethoxy)-1,3-difluorobenzene |
| SMILES | Fc1cc(CBr)cc(F)c1OCC1CC1 |
| InChI | InChI=1S/C11H11BrF2O/c12-5-8-3-9(13)11(10(14)4-8)15-6-7-1-2-7/h3-4,7H,1-2,5-6H2 |
| InChIKey | KXCKFLTXGURXCJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|