C12H13F2NOS — CID 88904674
(Z)-2-amino-2-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]ethenethiol (PubChem CID 88904674) has the molecular formula C12H13F2NOS and a molecular weight of 257.30 g/mol. Its IUPAC name is (Z)-2-amino-2-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]ethenethiol.
| Compound Name | (Z)-2-amino-2-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]ethenethiol |
|---|---|
| PubChem CID | 88904674 |
| Molecular Formula | C12H13F2NOS |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (Z)-2-amino-2-[4-(cyclopropylmethoxy)-3,5-difluorophenyl]ethenethiol |
| SMILES | N/C(=C\S)c1cc(F)c(OCC2CC2)c(F)c1 |
| InChI | InChI=1S/C12H13F2NOS/c13-9-3-8(11(15)6-17)4-10(14)12(9)16-5-7-1-2-7/h3-4,6-7,17H,1-2,5,15H2/b11-6- |
| InChIKey | YREWMFWHPDAZQL-WDZFZDKYSA-N |
| XLogP | 2.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|