C11H9F2NO — CID 69036852
2-(cyclopropylmethoxy)-3,5-difluorobenzonitrile (PubChem CID 69036852) has the molecular formula C11H9F2NO and a molecular weight of 209.19 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-3,5-difluorobenzonitrile.
| Compound Name | 2-(cyclopropylmethoxy)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 69036852 |
| Molecular Formula | C11H9F2NO |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(cyclopropylmethoxy)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(F)c1OCC1CC1 |
| InChI | InChI=1S/C11H9F2NO/c12-9-3-8(5-14)11(10(13)4-9)15-6-7-1-2-7/h3-4,7H,1-2,6H2 |
| InChIKey | FEBVRBNONAYMTD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |