C16H19BrF2O2 — CID 102898787
2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1-oxaspiro[4.4]nonane (PubChem CID 102898787) has the molecular formula C16H19BrF2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1-oxaspiro[4.4]nonane.
| Compound Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1-oxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 102898787 |
| Molecular Formula | C16H19BrF2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-1-oxaspiro[4.4]nonane |
| SMILES | Fc1cc(CBr)cc(F)c1OCC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C16H19BrF2O2/c17-9-11-7-13(18)15(14(19)8-11)20-10-12-3-6-16(21-12)4-1-2-5-16/h7-8,12H,1-6,9-10H2 |
| InChIKey | IICFECLUBAOYGP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|