C17H23BrO3 — CID 102898749
2-[[5-(bromomethyl)-2-methoxyphenoxy]methyl]-1-oxaspiro[4.4]nonane (PubChem CID 102898749) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[[5-(bromomethyl)-2-methoxyphenoxy]methyl]-1-oxaspiro[4.4]nonane.
| Compound Name | 2-[[5-(bromomethyl)-2-methoxyphenoxy]methyl]-1-oxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 102898749 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-[[5-(bromomethyl)-2-methoxyphenoxy]methyl]-1-oxaspiro[4.4]nonane |
| SMILES | COc1ccc(CBr)cc1OCC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C17H23BrO3/c1-19-15-5-4-13(11-18)10-16(15)20-12-14-6-9-17(21-14)7-2-3-8-17/h4-5,10,14H,2-3,6-9,11-12H2,1H3 |
| InChIKey | YNOJSQHLMLRRKF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|