C15H21F2NO — CID 82930013
2-(4-cycloheptyloxy-3,5-difluorophenyl)ethanamine (PubChem CID 82930013) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-(4-cycloheptyloxy-3,5-difluorophenyl)ethanamine.
| Compound Name | 2-(4-cycloheptyloxy-3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 82930013 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(4-cycloheptyloxy-3,5-difluorophenyl)ethanamine |
| SMILES | NCCc1cc(F)c(OC2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C15H21F2NO/c16-13-9-11(7-8-18)10-14(17)15(13)19-12-5-3-1-2-4-6-12/h9-10,12H,1-8,18H2 |
| InChIKey | VXMFVNWCIQEGPA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |