C13H15F2NO — CID 114619870
(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methanamine (PubChem CID 114619870) has the molecular formula C13H15F2NO and a molecular weight of 239.27 g/mol. Its IUPAC name is (4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methanamine.
| Compound Name | (4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 114619870 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methanamine |
| SMILES | NCc1cc(F)c(OC2C=CCCC2)c(F)c1 |
| InChI | InChI=1S/C13H15F2NO/c14-11-6-9(8-16)7-12(15)13(11)17-10-4-2-1-3-5-10/h2,4,6-7,10H,1,3,5,8,16H2 |
| InChIKey | CRXKWRSVFYGSMW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|