C15H19F2NO — CID 114620704
1-(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)propan-2-amine (PubChem CID 114620704) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)propan-2-amine.
| Compound Name | 1-(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114620704 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)propan-2-amine |
| SMILES | CC(N)Cc1cc(F)c(OC2C=CCCC2)c(F)c1 |
| InChI | InChI=1S/C15H19F2NO/c1-10(18)7-11-8-13(16)15(14(17)9-11)19-12-5-3-2-4-6-12/h3,5,8-10,12H,2,4,6-7,18H2,1H3 |
| InChIKey | BROWEXLDDDJFFC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|