C16H21F2NO — CID 114619873
N-[(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methyl]propan-2-amine (PubChem CID 114619873) has the molecular formula C16H21F2NO and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methyl]propan-2-amine.
| Compound Name | N-[(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 114619873 |
| Molecular Formula | C16H21F2NO |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(4-cyclohex-2-en-1-yloxy-3,5-difluorophenyl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(F)c(OC2C=CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H21F2NO/c1-11(2)19-10-12-8-14(17)16(15(18)9-12)20-13-6-4-3-5-7-13/h4,6,8-9,11,13,19H,3,5,7,10H2,1-2H3 |
| InChIKey | PJMZOSBJPZEFMN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|