C17H23Br2NO — CID 107743748
N-[(3,5-dibromo-4-cyclohex-2-en-1-yloxyphenyl)methyl]-2-methylpropan-2-amine (PubChem CID 107743748) has the molecular formula C17H23Br2NO and a molecular weight of 417.19 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-cyclohex-2-en-1-yloxyphenyl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(3,5-dibromo-4-cyclohex-2-en-1-yloxyphenyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107743748 |
| Molecular Formula | C17H23Br2NO |
| Molecular Weight | 417.19 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | N-[(3,5-dibromo-4-cyclohex-2-en-1-yloxyphenyl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cc(Br)c(OC2C=CCCC2)c(Br)c1 |
| InChI | InChI=1S/C17H23Br2NO/c1-17(2,3)20-11-12-9-14(18)16(15(19)10-12)21-13-7-5-4-6-8-13/h5,7,9-10,13,20H,4,6,8,11H2,1-3H3 |
| InChIKey | ABWHMWOYXPCKNZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.19 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|