C11H13N3O2 — CID 170464654
2-amino-5-[4-(methylamino)but-1-ynyl]pyridine-3-carboxylic acid (PubChem CID 170464654) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-amino-5-[4-(methylamino)but-1-ynyl]pyridine-3-carboxylic acid.
| Compound Name | 2-amino-5-[4-(methylamino)but-1-ynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170464654 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-amino-5-[4-(methylamino)but-1-ynyl]pyridine-3-carboxylic acid |
| SMILES | CNCCC#Cc1cnc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-13-5-3-2-4-8-6-9(11(15)16)10(12)14-7-8/h6-7,13H,3,5H2,1H3,(H2,12,14)(H,15,16) |
| InChIKey | MMELCIAXZTYWFP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|