C11H12F3N3 — CID 170464899
5-[4-(methylamino)but-1-ynyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 170464899) has the molecular formula C11H12F3N3 and a molecular weight of 243.23 g/mol. Its IUPAC name is 5-[4-(methylamino)but-1-ynyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[4-(methylamino)but-1-ynyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170464899 |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-[4-(methylamino)but-1-ynyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | CNCCC#Cc1cnc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3N3/c1-16-5-3-2-4-8-6-9(11(12,13)14)10(15)17-7-8/h6-7,16H,3,5H2,1H3,(H2,15,17) |
| InChIKey | BJBRKDSPLZEXKE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|