C12H11BrF3N — CID 170465425
4-[4-bromo-2-(trifluoromethyl)phenyl]-N-methylbut-3-yn-1-amine (PubChem CID 170465425) has the molecular formula C12H11BrF3N and a molecular weight of 306.13 g/mol. Its IUPAC name is 4-[4-bromo-2-(trifluoromethyl)phenyl]-N-methylbut-3-yn-1-amine.
| Compound Name | 4-[4-bromo-2-(trifluoromethyl)phenyl]-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170465425 |
| Molecular Formula | C12H11BrF3N |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-[4-bromo-2-(trifluoromethyl)phenyl]-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11BrF3N/c1-17-7-3-2-4-9-5-6-10(13)8-11(9)12(14,15)16/h5-6,8,17H,3,7H2,1H3 |
| InChIKey | FWUMATCCAJOWBQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|