C12H12ClNO2 — CID 170464553
3-chloro-5-[4-(methylamino)but-1-ynyl]benzoic acid (PubChem CID 170464553) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-chloro-5-[4-(methylamino)but-1-ynyl]benzoic acid.
| Compound Name | 3-chloro-5-[4-(methylamino)but-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 170464553 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-chloro-5-[4-(methylamino)but-1-ynyl]benzoic acid |
| SMILES | CNCCC#Cc1cc(Cl)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H12ClNO2/c1-14-5-3-2-4-9-6-10(12(15)16)8-11(13)7-9/h6-8,14H,3,5H2,1H3,(H,15,16) |
| InChIKey | WAXFSPAHUZBBCD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|