C18H8Cl2O4 — CID 19870020
3-[4-(3-carboxy-5-chlorophenyl)buta-1,3-diynyl]-5-chlorobenzoic acid (PubChem CID 19870020) has the molecular formula C18H8Cl2O4 and a molecular weight of 359.16 g/mol. Its IUPAC name is 3-[4-(3-carboxy-5-chlorophenyl)buta-1,3-diynyl]-5-chlorobenzoic acid.
| Compound Name | 3-[4-(3-carboxy-5-chlorophenyl)buta-1,3-diynyl]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 19870020 |
| Molecular Formula | C18H8Cl2O4 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 3-[4-(3-carboxy-5-chlorophenyl)buta-1,3-diynyl]-5-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(C#CC#Cc2cc(Cl)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H8Cl2O4/c19-15-7-11(5-13(9-15)17(21)22)3-1-2-4-12-6-14(18(23)24)10-16(20)8-12/h5-10H,(H,21,22)(H,23,24) |
| InChIKey | ZCPNHJHFJVHTKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|