C43H20O11 — CID 118591984
5-[4-[3-[4-[3-carboxy-5-(1-hydroxyethenyl)phenyl]buta-1,3-diynyl]-5-[4-(3,5-dicarboxyphenyl)buta-1,3-diynyl]phenyl]buta-1,3-diynyl]benzene-1,3-dicarboxylic acid (PubChem CID 118591984) has the molecular formula C43H20O11 and a molecular weight of 712.62 g/mol. Its IUPAC name is 5-[4-[3-[4-[3-carboxy-5-(1-hydroxyethenyl)phenyl]buta-1,3-diynyl]-5-[4-(3,5-dicarboxyphenyl)buta-1,3-diynyl]phenyl]buta-1,3-diynyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[4-[3-[4-[3-carboxy-5-(1-hydroxyethenyl)phenyl]buta-1,3-diynyl]-5-[4-(3,5-dicarboxyphenyl)buta-1,3-diynyl]phenyl]buta-1,3-diynyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 118591984 |
| Molecular Formula | C43H20O11 |
| Molecular Weight | 712.62 g/mol |
| Exact Mass | 712.10 |
| IUPAC Name | 5-[4-[3-[4-[3-carboxy-5-(1-hydroxyethenyl)phenyl]buta-1,3-diynyl]-5-[4-(3,5-dicarboxyphenyl)buta-1,3-diynyl]phenyl]buta-1,3-diynyl]benzene-1,3-dicarboxylic acid |
| SMILES | C=C(O)c1cc(C#CC#Cc2cc(C#CC#Cc3cc(C(=O)O)cc(C(=O)O)c3)cc(C#CC#Cc3cc(C(=O)O)cc(C(=O)O)c3)c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C43H20O11/c1-26(44)33-17-30(18-34(23-33)39(45)46)11-5-2-8-27-14-28(9-3-6-12-31-19-35(40(47)48)24-36(20-31)41(49)50)16-29(15-27)10-4-7-13-32-21-37(42(51)52)25-38(22-32)43(53)54/h14-25,44H,1H2,(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | VJRFPMZIOFMBCP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|