C12H13N3 — CID 170464446
4-(3H-benzimidazol-5-yl)-N-methylbut-3-yn-1-amine (PubChem CID 170464446) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-(3H-benzimidazol-5-yl)-N-methylbut-3-yn-1-amine.
| Compound Name | 4-(3H-benzimidazol-5-yl)-N-methylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 170464446 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-(3H-benzimidazol-5-yl)-N-methylbut-3-yn-1-amine |
| SMILES | CNCCC#Cc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H13N3/c1-13-7-3-2-4-10-5-6-11-12(8-10)15-9-14-11/h5-6,8-9,13H,3,7H2,1H3,(H,14,15) |
| InChIKey | BRLBQXSTVKJTEM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|