C12H9ClO2 — CID 170468009
5-(4-chlorobut-1-ynyl)benzene-1,3-dicarbaldehyde (PubChem CID 170468009) has the molecular formula C12H9ClO2 and a molecular weight of 220.65 g/mol. Its IUPAC name is 5-(4-chlorobut-1-ynyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(4-chlorobut-1-ynyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 170468009 |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 5-(4-chlorobut-1-ynyl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C#CCCCl)cc(C=O)c1 |
| InChI | InChI=1S/C12H9ClO2/c13-4-2-1-3-10-5-11(8-14)7-12(6-10)9-15/h5-9H,2,4H2 |
| InChIKey | CWCWHXULZVDANR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|