C11H8O2S — CID 169486823
5-(3-sulfanylprop-1-ynyl)benzene-1,3-dicarbaldehyde (PubChem CID 169486823) has the molecular formula C11H8O2S and a molecular weight of 204.25 g/mol. Its IUPAC name is 5-(3-sulfanylprop-1-ynyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(3-sulfanylprop-1-ynyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 169486823 |
| Molecular Formula | C11H8O2S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 5-(3-sulfanylprop-1-ynyl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C#CCS)cc(C=O)c1 |
| InChI | InChI=1S/C11H8O2S/c12-7-10-4-9(2-1-3-14)5-11(6-10)8-13/h4-8,14H,3H2 |
| InChIKey | JWSUIYKLBGNTHU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|