C10H10N2OS — CID 169486919
3-(3-sulfanylprop-1-ynyl)benzohydrazide (PubChem CID 169486919) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-(3-sulfanylprop-1-ynyl)benzohydrazide.
| Compound Name | 3-(3-sulfanylprop-1-ynyl)benzohydrazide |
|---|---|
| PubChem CID | 169486919 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-(3-sulfanylprop-1-ynyl)benzohydrazide |
| SMILES | NNC(=O)c1cccc(C#CCS)c1 |
| InChI | InChI=1S/C10H10N2OS/c11-12-10(13)9-5-1-3-8(7-9)4-2-6-14/h1,3,5,7,14H,6,11H2,(H,12,13) |
| InChIKey | UOXIPVYMMSYZDP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|