C10H9NO2 — CID 60816355
3-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 60816355) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60816355 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | NC(=O)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C10H9NO2/c11-10(13)9-5-1-3-8(7-9)4-2-6-12/h1,3,5,7,12H,6H2,(H2,11,13) |
| InChIKey | ABOXBFWOINMGJV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|