C13H15NO — CID 69120535
3-(3,3-dimethylbut-1-ynyl)benzamide (PubChem CID 69120535) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-ynyl)benzamide.
| Compound Name | 3-(3,3-dimethylbut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 69120535 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-(3,3-dimethylbut-1-ynyl)benzamide |
| SMILES | CC(C)(C)C#Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C13H15NO/c1-13(2,3)8-7-10-5-4-6-11(9-10)12(14)15/h4-6,9H,1-3H3,(H2,14,15) |
| InChIKey | GZOSUXLNESXVGT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|