C19H20N2O5S2 — CID 42610285
3-(3,3-dimethylbut-1-ynyl)-N-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 42610285) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-(3,3-dimethylbut-1-ynyl)-N-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 3-(3,3-dimethylbut-1-ynyl)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42610285 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-(3,3-dimethylbut-1-ynyl)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | CC(C)(C)C#Cc1cccc(C(=O)NS(=O)(=O)c2ccccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H20N2O5S2/c1-19(2,3)12-11-14-7-6-8-15(13-14)18(22)21-28(25,26)17-10-5-4-9-16(17)27(20,23)24/h4-10,13H,1-3H3,(H,21,22)(H2,20,23,24) |
| InChIKey | IARWLUOEHFSUQJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|