C15H13BrF2N2O6S2 — CID 59581706
4-bromo-3-(2,2-difluoroethoxy)-N-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 59581706) has the molecular formula C15H13BrF2N2O6S2 and a molecular weight of 499.31 g/mol. Its IUPAC name is 4-bromo-3-(2,2-difluoroethoxy)-N-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 4-bromo-3-(2,2-difluoroethoxy)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 59581706 |
| Molecular Formula | C15H13BrF2N2O6S2 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 497.94 |
| IUPAC Name | 4-bromo-3-(2,2-difluoroethoxy)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | NS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)c1ccc(Br)c(OCC(F)F)c1 |
| InChI | InChI=1S/C15H13BrF2N2O6S2/c16-10-6-5-9(7-11(10)26-8-14(17)18)15(21)20-28(24,25)13-4-2-1-3-12(13)27(19,22)23/h1-7,14H,8H2,(H,20,21)(H2,19,22,23) |
| InChIKey | MXYVFVQKFRSNPZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |