C19H14N4O6S2 — CID 42610216
4-([1,3]oxazolo[4,5-c]pyridin-2-yl)-N-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 42610216) has the molecular formula C19H14N4O6S2 and a molecular weight of 458.48 g/mol. Its IUPAC name is 4-([1,3]oxazolo[4,5-c]pyridin-2-yl)-N-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 4-([1,3]oxazolo[4,5-c]pyridin-2-yl)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42610216 |
| Molecular Formula | C19H14N4O6S2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 4-([1,3]oxazolo[4,5-c]pyridin-2-yl)-N-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | NS(=O)(=O)c1ccccc1S(=O)(=O)NC(=O)c1ccc(-c2nc3cnccc3o2)cc1 |
| InChI | InChI=1S/C19H14N4O6S2/c20-30(25,26)16-3-1-2-4-17(16)31(27,28)23-18(24)12-5-7-13(8-6-12)19-22-14-11-21-10-9-15(14)29-19/h1-11H,(H,23,24)(H2,20,25,26) |
| InChIKey | OGZSAXPFKNNAKN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |