C17H11N3O3 — CID 39311457
N-[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]furan-2-carboxamide (PubChem CID 39311457) has the molecular formula C17H11N3O3 and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39311457 |
| Molecular Formula | C17H11N3O3 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-[4-([1,3]oxazolo[4,5-c]pyridin-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3cnccc3o2)cc1)c1ccco1 |
| InChI | InChI=1S/C17H11N3O3/c21-16(15-2-1-9-22-15)19-12-5-3-11(4-6-12)17-20-13-10-18-8-7-14(13)23-17/h1-10H,(H,19,21) |
| InChIKey | OTAJUCXOZOTCPB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |