C22H20N2O3 — CID 1016768
N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide (PubChem CID 1016768) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1016768 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]furan-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2nc3cc(NC(=O)c4ccco4)ccc3o2)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-22(2,3)15-8-6-14(7-9-15)21-24-17-13-16(10-11-18(17)27-21)23-20(25)19-5-4-12-26-19/h4-13H,1-3H3,(H,23,25) |
| InChIKey | NDRFCOKOHBSPQW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |