C16H16N2O5S2 — CID 89187439
4-prop-1-en-2-yl-N-(2-sulfamoylphenyl)sulfonylbenzamide (PubChem CID 89187439) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-prop-1-en-2-yl-N-(2-sulfamoylphenyl)sulfonylbenzamide.
| Compound Name | 4-prop-1-en-2-yl-N-(2-sulfamoylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 89187439 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4-prop-1-en-2-yl-N-(2-sulfamoylphenyl)sulfonylbenzamide |
| SMILES | C=C(C)c1ccc(C(=O)NS(=O)(=O)c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-11(2)12-7-9-13(10-8-12)16(19)18-25(22,23)15-6-4-3-5-14(15)24(17,20)21/h3-10H,1H2,2H3,(H,18,19)(H2,17,20,21) |
| InChIKey | HKSFPIRPQXNMLB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |